C8H9BrN2OS — CID 168506383
4-(bromomethyl)-1-(1,3-thiazol-2-yl)pyrrolidin-2-one (PubChem CID 168506383) has the molecular formula C8H9BrN2OS and a molecular weight of 261.14 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(1,3-thiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506383 |
| Molecular Formula | C8H9BrN2OS |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 4-(bromomethyl)-1-(1,3-thiazol-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1nccs1 |
| InChI | InChI=1S/C8H9BrN2OS/c9-4-6-3-7(12)11(5-6)8-10-1-2-13-8/h1-2,6H,3-5H2 |
| InChIKey | PSAMXOUJQNRPQJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|