C12H16Br2N2OS — CID 168503616
1-(5-bromo-4-tert-butyl-1,3-thiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one (PubChem CID 168503616) has the molecular formula C12H16Br2N2OS and a molecular weight of 396.15 g/mol. Its IUPAC name is 1-(5-bromo-4-tert-butyl-1,3-thiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-bromo-4-tert-butyl-1,3-thiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503616 |
| Molecular Formula | C12H16Br2N2OS |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 1-(5-bromo-4-tert-butyl-1,3-thiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one |
| SMILES | CC(C)(C)c1nc(N2CC(CBr)CC2=O)sc1Br |
| InChI | InChI=1S/C12H16Br2N2OS/c1-12(2,3)9-10(14)18-11(15-9)16-6-7(5-13)4-8(16)17/h7H,4-6H2,1-3H3 |
| InChIKey | XJWODSRRWZQWOQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|