C8H11BrN4OS — CID 168504311
4-(bromomethyl)-1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)pyrrolidin-2-one (PubChem CID 168504311) has the molecular formula C8H11BrN4OS and a molecular weight of 291.17 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168504311 |
| Molecular Formula | C8H11BrN4OS |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 4-(bromomethyl)-1-(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)pyrrolidin-2-one |
| SMILES | CSc1n[nH]c(N2CC(CBr)CC2=O)n1 |
| InChI | InChI=1S/C8H11BrN4OS/c1-15-8-10-7(11-12-8)13-4-5(3-9)2-6(13)14/h5H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | KPHOCHDVOQPGMM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|