C8H8BrF3N4O — CID 168506409
4-(bromomethyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one (PubChem CID 168506409) has the molecular formula C8H8BrF3N4O and a molecular weight of 313.08 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506409 |
| Molecular Formula | C8H8BrF3N4O |
| Molecular Weight | 313.08 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 4-(bromomethyl)-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8BrF3N4O/c9-2-4-1-5(17)16(3-4)7-13-6(14-15-7)8(10,11)12/h4H,1-3H2,(H,13,14,15) |
| InChIKey | IJXZURJUPOWCLJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.08 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|