C9H7F3N4O — CID 168503090
4-ethynyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one (PubChem CID 168503090) has the molecular formula C9H7F3N4O and a molecular weight of 244.18 g/mol. Its IUPAC name is 4-ethynyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503090 |
| Molecular Formula | C9H7F3N4O |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-ethynyl-1-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2n[nH]c(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C9H7F3N4O/c1-2-5-3-6(17)16(4-5)8-13-7(14-15-8)9(10,11)12/h1,5H,3-4H2,(H,13,14,15) |
| InChIKey | XGTWWMMPAKGKSH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|