C12H9F2NO — CID 168502729
1-(3,5-difluorophenyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168502729) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(3,5-difluorophenyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502729 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 1-(3,5-difluorophenyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C12H9F2NO/c1-2-8-3-12(16)15(7-8)11-5-9(13)4-10(14)6-11/h1,4-6,8H,3,7H2 |
| InChIKey | GFHMCRKHHLREAU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|