C13H13NO2 — CID 168500928
4-ethynyl-1-(3-methoxyphenyl)pyrrolidin-2-one (PubChem CID 168500928) has the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. Its IUPAC name is 4-ethynyl-1-(3-methoxyphenyl)pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-(3-methoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168500928 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-ethynyl-1-(3-methoxyphenyl)pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C13H13NO2/c1-3-10-7-13(15)14(9-10)11-5-4-6-12(8-11)16-2/h1,4-6,8,10H,7,9H2,2H3 |
| InChIKey | SEINNOLPOKVEOA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|