C13H12N2O3 — CID 168500772
methyl 4-(4-ethynyl-2-oxopyrrolidin-1-yl)pyridine-2-carboxylate (PubChem CID 168500772) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl 4-(4-ethynyl-2-oxopyrrolidin-1-yl)pyridine-2-carboxylate.
| Compound Name | methyl 4-(4-ethynyl-2-oxopyrrolidin-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 168500772 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | methyl 4-(4-ethynyl-2-oxopyrrolidin-1-yl)pyridine-2-carboxylate |
| SMILES | C#CC1CC(=O)N(c2ccnc(C(=O)OC)c2)C1 |
| InChI | InChI=1S/C13H12N2O3/c1-3-9-6-12(16)15(8-9)10-4-5-14-11(7-10)13(17)18-2/h1,4-5,7,9H,6,8H2,2H3 |
| InChIKey | CNIYKJGAMFHUGX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|