C17H20N2O2 — CID 168500213
N-[4-(4-ethynyl-2-oxopyrrolidin-1-yl)phenyl]-2,2-dimethylpropanamide (PubChem CID 168500213) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[4-(4-ethynyl-2-oxopyrrolidin-1-yl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(4-ethynyl-2-oxopyrrolidin-1-yl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 168500213 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-[4-(4-ethynyl-2-oxopyrrolidin-1-yl)phenyl]-2,2-dimethylpropanamide |
| SMILES | C#CC1CC(=O)N(c2ccc(NC(=O)C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C17H20N2O2/c1-5-12-10-15(20)19(11-12)14-8-6-13(7-9-14)18-16(21)17(2,3)4/h1,6-9,12H,10-11H2,2-4H3,(H,18,21) |
| InChIKey | WEDGCIOTOPWCRJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|