C19H20N2O2S2 — CID 55544056
N,1-bis(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55544056) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N,1-bis(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N,1-bis(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55544056 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N,1-bis(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CSc1ccc(NC(=O)C2CC(=O)N(c3ccc(SC)cc3)C2)cc1 |
| InChI | InChI=1S/C19H20N2O2S2/c1-24-16-7-3-14(4-8-16)20-19(23)13-11-18(22)21(12-13)15-5-9-17(25-2)10-6-15/h3-10,13H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | RXUBKMZGRODUOD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |