C16H21N3O3S — CID 43072311
N'-(2-methylpropanoyl)-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 43072311) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N'-(2-methylpropanoyl)-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | N'-(2-methylpropanoyl)-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 43072311 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N'-(2-methylpropanoyl)-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CSc1ccc(N2CC(C(=O)NNC(=O)C(C)C)CC2=O)cc1 |
| InChI | InChI=1S/C16H21N3O3S/c1-10(2)15(21)17-18-16(22)11-8-14(20)19(9-11)12-4-6-13(23-3)7-5-12/h4-7,10-11H,8-9H2,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | JYVZXCKDAJZWJA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|