C17H22N2O4S — CID 119234133
5-[[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid (PubChem CID 119234133) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 5-[[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234133 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 5-[[1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
| SMILES | CSc1ccc(N2CC(C(=O)NCCCCC(=O)O)CC2=O)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-24-14-7-5-13(6-8-14)19-11-12(10-15(19)20)17(23)18-9-3-2-4-16(21)22/h5-8,12H,2-4,9-11H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | IBRGMJJDTJSPGJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|