C18H22ClFN2O4 — CID 120524006
7-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]heptanoic acid (PubChem CID 120524006) has the molecular formula C18H22ClFN2O4 and a molecular weight of 384.84 g/mol. Its IUPAC name is 7-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]heptanoic acid.
| Compound Name | 7-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 120524006 |
| Molecular Formula | C18H22ClFN2O4 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 7-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)C1CC(=O)N(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C18H22ClFN2O4/c19-14-7-6-13(10-15(14)20)22-11-12(9-16(22)23)18(26)21-8-4-2-1-3-5-17(24)25/h6-7,10,12H,1-5,8-9,11H2,(H,21,26)(H,24,25) |
| InChIKey | OAFVZFOESHIDSE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|