C12H12ClFN2O4S — CID 124591586
(3S)-1-(4-chloro-3-fluorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 124591586) has the molecular formula C12H12ClFN2O4S and a molecular weight of 334.76 g/mol. Its IUPAC name is (3S)-1-(4-chloro-3-fluorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chloro-3-fluorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124591586 |
| Molecular Formula | C12H12ClFN2O4S |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | (3S)-1-(4-chloro-3-fluorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)[C@H]1CC(=O)N(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C12H12ClFN2O4S/c1-21(19,20)15-12(18)7-4-11(17)16(6-7)8-2-3-9(13)10(14)5-8/h2-3,5,7H,4,6H2,1H3,(H,15,18)/t7-/m0/s1 |
| InChIKey | IOCCYRREUONWSP-ZETCQYMHSA-N |
| XLogP | 0.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |