C12H12Cl2N2O4S — CID 155525716
1-(3,4-dichlorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 155525716) has the molecular formula C12H12Cl2N2O4S and a molecular weight of 351.21 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 155525716 |
| Molecular Formula | C12H12Cl2N2O4S |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-methylsulfonyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)C1CC(=O)N(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H12Cl2N2O4S/c1-21(19,20)15-12(18)7-4-11(17)16(6-7)8-2-3-9(13)10(14)5-8/h2-3,5,7H,4,6H2,1H3,(H,15,18) |
| InChIKey | WFUOWPWPJNMJFE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |