C20H19Cl2N3O2 — CID 126262377
(3R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126262377) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is (3R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126262377 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (3R)-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)N/N=C\c3ccc(Cl)c(Cl)c3)CC2=O)cc1C |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-12-3-5-16(7-13(12)2)25-11-15(9-19(25)26)20(27)24-23-10-14-4-6-17(21)18(22)8-14/h3-8,10,15H,9,11H2,1-2H3,(H,24,27)/b23-10-/t15-/m1/s1 |
| InChIKey | KJJVTPZHUOZYPO-VEKQOBIDSA-N |
| XLogP | 4.11 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|