C28H27Cl2N3O4 — CID 126269211
(3R)-N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126269211) has the molecular formula C28H27Cl2N3O4 and a molecular weight of 540.45 g/mol. Its IUPAC name is (3R)-N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126269211 |
| Molecular Formula | C28H27Cl2N3O4 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | (3R)-N-[(E)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)[C@@H]2CC(=O)N(c3ccc(C)cc3)C2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H27Cl2N3O4/c1-3-36-26-13-19(7-11-25(26)37-17-20-6-10-23(29)24(30)12-20)15-31-32-28(35)21-14-27(34)33(16-21)22-8-4-18(2)5-9-22/h4-13,15,21H,3,14,16-17H2,1-2H3,(H,32,35)/b31-15+/t21-/m1/s1 |
| InChIKey | KANYXMUOKLNFCF-NZBVYFIMSA-N |
| XLogP | 5.78 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|