C26H24ClN3O4 — CID 126265368
(3S)-1-(4-chlorophenyl)-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide (PubChem CID 126265368) has the molecular formula C26H24ClN3O4 and a molecular weight of 477.95 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorophenyl)-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126265368 |
| Molecular Formula | C26H24ClN3O4 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-N-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H24ClN3O4/c1-33-24-13-19(7-12-23(24)34-17-18-5-3-2-4-6-18)15-28-29-26(32)20-14-25(31)30(16-20)22-10-8-21(27)9-11-22/h2-13,15,20H,14,16-17H2,1H3,(H,29,32)/b28-15-/t20-/m0/s1 |
| InChIKey | XENXBCJKWBNGRY-BWHPKIFCSA-N |
| XLogP | 4.43 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|