C27H27N3O3 — CID 126171787
(3R)-1-(3,4-dimethylphenyl)-5-oxo-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide (PubChem CID 126171787) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is (3R)-1-(3,4-dimethylphenyl)-5-oxo-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(3,4-dimethylphenyl)-5-oxo-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126171787 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (3R)-1-(3,4-dimethylphenyl)-5-oxo-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)N/N=C\c3cccc(OCc4ccccc4)c3)CC2=O)cc1C |
| InChI | InChI=1S/C27H27N3O3/c1-19-11-12-24(13-20(19)2)30-17-23(15-26(30)31)27(32)29-28-16-22-9-6-10-25(14-22)33-18-21-7-4-3-5-8-21/h3-14,16,23H,15,17-18H2,1-2H3,(H,29,32)/b28-16-/t23-/m1/s1 |
| InChIKey | YVQJRGAHNZBVFM-GXZQEHIMSA-N |
| XLogP | 4.39 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|