C25H21ClFN3O3 — CID 126271124
(3S)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126271124) has the molecular formula C25H21ClFN3O3 and a molecular weight of 465.91 g/mol. Its IUPAC name is (3S)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126271124 |
| Molecular Formula | C25H21ClFN3O3 |
| Molecular Weight | 465.91 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (3S)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2ccccc2Cl)c1)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H21ClFN3O3/c26-23-7-2-1-5-18(23)16-33-22-6-3-4-17(12-22)14-28-29-25(32)19-13-24(31)30(15-19)21-10-8-20(27)9-11-21/h1-12,14,19H,13,15-16H2,(H,29,32)/b28-14-/t19-/m0/s1 |
| InChIKey | NAURTYFRIJHIPV-RYNWWGPNSA-N |
| XLogP | 4.56 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.91 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|