C25H20Cl2FN3O3 — CID 126258363
(3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126258363) has the molecular formula C25H20Cl2FN3O3 and a molecular weight of 500.36 g/mol. Its IUPAC name is (3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126258363 |
| Molecular Formula | C25H20Cl2FN3O3 |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | (3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2c(Cl)cccc2Cl)c1)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C25H20Cl2FN3O3/c26-22-5-2-6-23(27)21(22)15-34-20-4-1-3-16(11-20)13-29-30-25(33)17-12-24(32)31(14-17)19-9-7-18(28)8-10-19/h1-11,13,17H,12,14-15H2,(H,30,33)/b29-13-/t17-/m0/s1 |
| InChIKey | RCVLMMRJGZBAOY-YNJKENKXSA-N |
| XLogP | 5.21 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|