C27H25Cl2N3O4 — CID 126262577
(3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126262577) has the molecular formula C27H25Cl2N3O4 and a molecular weight of 526.42 g/mol. Its IUPAC name is (3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126262577 |
| Molecular Formula | C27H25Cl2N3O4 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | (3S)-N-[(Z)-[3-[(2,6-dichlorophenyl)methoxy]phenyl]methylideneamino]-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(N2C[C@@H](C(=O)N/N=C\c3cccc(OCc4c(Cl)cccc4Cl)c3)CC2=O)cc1 |
| InChI | InChI=1S/C27H25Cl2N3O4/c1-2-35-21-11-9-20(10-12-21)32-16-19(14-26(32)33)27(34)31-30-15-18-5-3-6-22(13-18)36-17-23-24(28)7-4-8-25(23)29/h3-13,15,19H,2,14,16-17H2,1H3,(H,31,34)/b30-15-/t19-/m0/s1 |
| InChIKey | KXCGVGHJPGZFPU-UEGXWDRTSA-N |
| XLogP | 5.47 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|