C25H22ClN3O3 — CID 126265507
(3R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 126265507) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is (3R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126265507 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (3R)-N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(Cl)cc2)cc1)[C@@H]1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C25H22ClN3O3/c26-21-10-6-19(7-11-21)17-32-23-12-8-18(9-13-23)15-27-28-25(31)20-14-24(30)29(16-20)22-4-2-1-3-5-22/h1-13,15,20H,14,16-17H2,(H,28,31)/b27-15-/t20-/m1/s1 |
| InChIKey | YUJJDRGZMUQRDM-UXLQVQPCSA-N |
| XLogP | 4.42 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|