C19H18ClNO4 — CID 1272534
methyl (3R)-1-[4-[(4-chlorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 1272534) has the molecular formula C19H18ClNO4 and a molecular weight of 359.81 g/mol. Its IUPAC name is methyl (3R)-1-[4-[(4-chlorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[4-[(4-chlorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 1272534 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | methyl (3R)-1-[4-[(4-chlorophenyl)methoxy]phenyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)N(c2ccc(OCc3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C19H18ClNO4/c1-24-19(23)14-10-18(22)21(11-14)16-6-8-17(9-7-16)25-12-13-2-4-15(20)5-3-13/h2-9,14H,10-12H2,1H3/t14-/m1/s1 |
| InChIKey | XDIBIJQBEQAMJT-CQSZACIVSA-N |
| XLogP | 3.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |