C26H23F2N3O4 — CID 126277703
(3R)-1-(4-fluorophenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide (PubChem CID 126277703) has the molecular formula C26H23F2N3O4 and a molecular weight of 479.48 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-fluorophenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126277703 |
| Molecular Formula | C26H23F2N3O4 |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H]2CC(=O)N(c3ccc(F)cc3)C2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H23F2N3O4/c1-34-24-12-18(4-11-23(24)35-16-17-2-5-20(27)6-3-17)14-29-30-26(33)19-13-25(32)31(15-19)22-9-7-21(28)8-10-22/h2-12,14,19H,13,15-16H2,1H3,(H,30,33)/b29-14-/t19-/m1/s1 |
| InChIKey | MJISLKYWCOLERD-GLYGWYKASA-N |
| XLogP | 4.06 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|