C28H28FN3O4 — CID 126265775
(3S)-1-(3,4-dimethylphenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide (PubChem CID 126265775) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is (3S)-1-(3,4-dimethylphenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(3,4-dimethylphenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126265775 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (3S)-1-(3,4-dimethylphenyl)-N-[(Z)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@H]2CC(=O)N(c3ccc(C)c(C)c3)C2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H28FN3O4/c1-18-4-10-24(12-19(18)2)32-16-22(14-27(32)33)28(34)31-30-15-21-7-11-25(26(13-21)35-3)36-17-20-5-8-23(29)9-6-20/h4-13,15,22H,14,16-17H2,1-3H3,(H,31,34)/b30-15-/t22-/m0/s1 |
| InChIKey | BHAZYCKPZSFULH-IPVLUDNLSA-N |
| XLogP | 4.53 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|