C20H21N3O2 — CID 126159429
(3R)-N-[(Z)-benzylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126159429) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (3R)-N-[(Z)-benzylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[(Z)-benzylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126159429 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (3R)-N-[(Z)-benzylideneamino]-1-(3,4-dimethylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2C[C@H](C(=O)N/N=C\c3ccccc3)CC2=O)cc1C |
| InChI | InChI=1S/C20H21N3O2/c1-14-8-9-18(10-15(14)2)23-13-17(11-19(23)24)20(25)22-21-12-16-6-4-3-5-7-16/h3-10,12,17H,11,13H2,1-2H3,(H,22,25)/b21-12-/t17-/m1/s1 |
| InChIKey | HIERUNCEHCOMKN-CTPANLQCSA-N |
| XLogP | 2.81 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|