C22H23ClIN3O4 — CID 126267755
(3S)-1-(4-chlorophenyl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide (PubChem CID 126267755) has the molecular formula C22H23ClIN3O4 and a molecular weight of 555.80 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-chlorophenyl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126267755 |
| Molecular Formula | C22H23ClIN3O4 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-N-[(Z)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H]2CC(=O)N(c3ccc(Cl)cc3)C2)cc(I)c1OCC |
| InChI | InChI=1S/C22H23ClIN3O4/c1-3-30-19-10-14(9-18(24)21(19)31-4-2)12-25-26-22(29)15-11-20(28)27(13-15)17-7-5-16(23)6-8-17/h5-10,12,15H,3-4,11,13H2,1-2H3,(H,26,29)/b25-12-/t15-/m0/s1 |
| InChIKey | DFHWJZCLIAUKRW-JNXALSOLSA-N |
| XLogP | 4.25 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|