C23H26IN3O4 — CID 126268061
(3S)-N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 126268061) has the molecular formula C23H26IN3O4 and a molecular weight of 535.38 g/mol. Its IUPAC name is (3S)-N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126268061 |
| Molecular Formula | C23H26IN3O4 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (3S)-N-[(E)-(3,4-diethoxy-5-iodophenyl)methylideneamino]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)[C@H]2CC(=O)N(c3ccc(C)cc3)C2)cc(I)c1OCC |
| InChI | InChI=1S/C23H26IN3O4/c1-4-30-20-11-16(10-19(24)22(20)31-5-2)13-25-26-23(29)17-12-21(28)27(14-17)18-8-6-15(3)7-9-18/h6-11,13,17H,4-5,12,14H2,1-3H3,(H,26,29)/b25-13+/t17-/m0/s1 |
| InChIKey | FSBIVZXLVMCJBY-GDQCRLHRSA-N |
| XLogP | 3.90 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|