C15H16ClFN2O4 — CID 120520365
2-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid (PubChem CID 120520365) has the molecular formula C15H16ClFN2O4 and a molecular weight of 342.75 g/mol. Its IUPAC name is 2-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid.
| Compound Name | 2-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 120520365 |
| Molecular Formula | C15H16ClFN2O4 |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)C1CC(=O)N(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C15H16ClFN2O4/c1-8(15(22)23)18(2)14(21)9-5-13(20)19(7-9)10-3-4-11(16)12(17)6-10/h3-4,6,8-9H,5,7H2,1-2H3,(H,22,23) |
| InChIKey | OSSPAYXKFGEPGN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |