(3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid

C11H9F2NO3 — CID 2304169

IUPAC(3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@H]1CC(=O)N(c2ccc(F)c(F)c2)C1
InChIInChI=1S/C11H9F2NO3/c12-8-2-1-7(4-9(8)13)14-5-6(11(16)17)3-10(14)15/h1-2,4,6H,3,5H2,(H,16,17)/t6-/m0/s1
InChIKeyZONVRPYTUSSRDE-LURJTMIESA-N
MW241.19 g/mol
LogP1.40
Rot. Bonds2

About (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid

(3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 2304169) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name(3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid
PubChem CID2304169
Molecular FormulaC11H9F2NO3
Molecular Weight241.19 g/mol
Exact Mass241.06
IUPAC Name(3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid
SMILESO=C(O)[C@H]1CC(=O)N(c2ccc(F)c(F)c2)C1
InChIInChI=1S/C11H9F2NO3/c12-8-2-1-7(4-9(8)13)14-5-6(11(16)17)3-10(14)15/h1-2,4,6H,3,5H2,(H,16,17)/t6-/m0/s1
InChIKeyZONVRPYTUSSRDE-LURJTMIESA-N
XLogP1.40
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.19
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid (CID 2304169) is (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid is O=C(O)[C@H]1CC(=O)N(c2ccc(F)c(F)c2)C1.
What is the InChIKey of (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid?
The InChIKey is ZONVRPYTUSSRDE-LURJTMIESA-N. The full InChI is InChI=1S/C11H9F2NO3/c12-8-2-1-7(4-9(8)13)14-5-6(11(16)17)3-10(14)15/h1-2,4,6H,3,5H2,(H,16,17)/t6-/m0/s1.
What are the key properties of (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid?
(3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid has a molecular weight of 241.19 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-carboxylic acid is sourced from PubChem (CID 2304169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).