C16H18ClFN2O4 — CID 120534750
4-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid (PubChem CID 120534750) has the molecular formula C16H18ClFN2O4 and a molecular weight of 356.78 g/mol. Its IUPAC name is 4-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | 4-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120534750 |
| Molecular Formula | C16H18ClFN2O4 |
| Molecular Weight | 356.78 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-[[1-(4-chloro-3-fluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)C1CC(=O)N(c2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C16H18ClFN2O4/c1-9(2-5-15(22)23)19-16(24)10-6-14(21)20(8-10)11-3-4-12(17)13(18)7-11/h3-4,7,9-10H,2,5-6,8H2,1H3,(H,19,24)(H,22,23) |
| InChIKey | JMARKFSBTSEJBX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |