C22H24N2O2S — CID 42944494
N-[cyclopropyl(phenyl)methyl]-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 42944494) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[cyclopropyl(phenyl)methyl]-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[cyclopropyl(phenyl)methyl]-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42944494 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[cyclopropyl(phenyl)methyl]-1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CSc1ccc(N2CC(C(=O)NC(c3ccccc3)C3CC3)CC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-27-19-11-9-18(10-12-19)24-14-17(13-20(24)25)22(26)23-21(16-7-8-16)15-5-3-2-4-6-15/h2-6,9-12,16-17,21H,7-8,13-14H2,1H3,(H,23,26) |
| InChIKey | UVFYBNXJQOYQSM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |