C15H15NO3 — CID 168502814
1-[3-(1,3-dioxolan-2-yl)phenyl]-4-ethynylpyrrolidin-2-one (PubChem CID 168502814) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[3-(1,3-dioxolan-2-yl)phenyl]-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-[3-(1,3-dioxolan-2-yl)phenyl]-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502814 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-[3-(1,3-dioxolan-2-yl)phenyl]-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cccc(C3OCCO3)c2)C1 |
| InChI | InChI=1S/C15H15NO3/c1-2-11-8-14(17)16(10-11)13-5-3-4-12(9-13)15-18-6-7-19-15/h1,3-5,9,11,15H,6-8,10H2 |
| InChIKey | NUHSKVIVUVSWAH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|