C14H16N2O4 — CID 168698374
1-[3-(1,3-dioxolan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 168698374) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-[3-(1,3-dioxolan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[3-(1,3-dioxolan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168698374 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[3-(1,3-dioxolan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2cccc(C3OCCO3)c2)C1 |
| InChI | InChI=1S/C14H16N2O4/c15-13(18)10-7-12(17)16(8-10)11-3-1-2-9(6-11)14-19-4-5-20-14/h1-3,6,10,14H,4-5,7-8H2,(H2,15,18) |
| InChIKey | ZTSVFKBUBNPFJU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |