C15H14N2O — CID 168501334
4-ethynyl-1-(2-methyl-1H-indol-5-yl)pyrrolidin-2-one (PubChem CID 168501334) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-ethynyl-1-(2-methyl-1H-indol-5-yl)pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-(2-methyl-1H-indol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168501334 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 4-ethynyl-1-(2-methyl-1H-indol-5-yl)pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc3[nH]c(C)cc3c2)C1 |
| InChI | InChI=1S/C15H14N2O/c1-3-11-7-15(18)17(9-11)13-4-5-14-12(8-13)6-10(2)16-14/h1,4-6,8,11,16H,7,9H2,2H3 |
| InChIKey | SCJHIUCRTYJUJQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|