C12H15NO2 — CID 169218000
1-(3-methoxyphenyl)-4-methylpyrrolidin-2-one (PubChem CID 169218000) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-methylpyrrolidin-2-one.
| Compound Name | 1-(3-methoxyphenyl)-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 169218000 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-methylpyrrolidin-2-one |
| SMILES | COc1cccc(N2CC(C)CC2=O)c1 |
| InChI | InChI=1S/C12H15NO2/c1-9-6-12(14)13(8-9)10-4-3-5-11(7-10)15-2/h3-5,7,9H,6,8H2,1-2H3 |
| InChIKey | JXDMAHHUJYBZPC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |