C13H9ClF3NO — CID 168502351
1-[2-chloro-4-(trifluoromethyl)phenyl]-4-ethynylpyrrolidin-2-one (PubChem CID 168502351) has the molecular formula C13H9ClF3NO and a molecular weight of 287.67 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethyl)phenyl]-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502351 |
| Molecular Formula | C13H9ClF3NO |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C13H9ClF3NO/c1-2-8-5-12(19)18(7-8)11-4-3-9(6-10(11)14)13(15,16)17/h1,3-4,6,8H,5,7H2 |
| InChIKey | TYVPLAAVRGAXLF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|