C12H10ClNO2 — CID 168502395
1-(2-chloro-4-hydroxyphenyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168502395) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 1-(2-chloro-4-hydroxyphenyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2-chloro-4-hydroxyphenyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502395 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 1-(2-chloro-4-hydroxyphenyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2ccc(O)cc2Cl)C1 |
| InChI | InChI=1S/C12H10ClNO2/c1-2-8-5-12(16)14(7-8)11-4-3-9(15)6-10(11)13/h1,3-4,6,8,15H,5,7H2 |
| InChIKey | GSLWIQOAZATBDP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|