C13H9BrF3NO2 — CID 168502117
1-[2-bromo-5-(trifluoromethoxy)phenyl]-4-ethynylpyrrolidin-2-one (PubChem CID 168502117) has the molecular formula C13H9BrF3NO2 and a molecular weight of 348.12 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethoxy)phenyl]-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-[2-bromo-5-(trifluoromethoxy)phenyl]-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168502117 |
| Molecular Formula | C13H9BrF3NO2 |
| Molecular Weight | 348.12 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethoxy)phenyl]-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(c2cc(OC(F)(F)F)ccc2Br)C1 |
| InChI | InChI=1S/C13H9BrF3NO2/c1-2-8-5-12(19)18(7-8)11-6-9(3-4-10(11)14)20-13(15,16)17/h1,3-4,6,8H,5,7H2 |
| InChIKey | KATCQNFFRGKGII-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|