C11H8BrClF3NO2 — CID 168689366
1-[2-bromo-4-(trifluoromethoxy)phenyl]-4-chloropyrrolidin-2-one (PubChem CID 168689366) has the molecular formula C11H8BrClF3NO2 and a molecular weight of 358.54 g/mol. Its IUPAC name is 1-[2-bromo-4-(trifluoromethoxy)phenyl]-4-chloropyrrolidin-2-one.
| Compound Name | 1-[2-bromo-4-(trifluoromethoxy)phenyl]-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168689366 |
| Molecular Formula | C11H8BrClF3NO2 |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 1-[2-bromo-4-(trifluoromethoxy)phenyl]-4-chloropyrrolidin-2-one |
| SMILES | O=C1CC(Cl)CN1c1ccc(OC(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H8BrClF3NO2/c12-8-4-7(19-11(14,15)16)1-2-9(8)17-5-6(13)3-10(17)18/h1-2,4,6H,3,5H2 |
| InChIKey | RSTBOYKWMDPGDB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|