C13H11BrF3NO4 — CID 168694604
methyl 1-[2-bromo-5-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 168694604) has the molecular formula C13H11BrF3NO4 and a molecular weight of 382.13 g/mol. Its IUPAC name is methyl 1-[2-bromo-5-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-bromo-5-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694604 |
| Molecular Formula | C13H11BrF3NO4 |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | methyl 1-[2-bromo-5-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2cc(OC(F)(F)F)ccc2Br)C1 |
| InChI | InChI=1S/C13H11BrF3NO4/c1-21-12(20)7-4-11(19)18(6-7)10-5-8(2-3-9(10)14)22-13(15,16)17/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | NUOKPZDGVFLRGO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |