C12H12F3N3O3 — CID 168697980
1-[2-amino-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697980) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is 1-[2-amino-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[2-amino-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697980 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-[2-amino-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(c2ccc(OC(F)(F)F)cc2N)C1 |
| InChI | InChI=1S/C12H12F3N3O3/c13-12(14,15)21-7-1-2-9(8(16)4-7)18-5-6(11(17)20)3-10(18)19/h1-2,4,6H,3,5,16H2,(H2,17,20) |
| InChIKey | PWBGNYCNHGQMGD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|