C12H11ClF3NO3 — CID 168508761
4-(chloromethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 168508761) has the molecular formula C12H11ClF3NO3 and a molecular weight of 309.67 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508761 |
| Molecular Formula | C12H11ClF3NO3 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-(chloromethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C12H11ClF3NO3/c13-5-7-3-11(19)17(6-7)9-4-8(1-2-10(9)18)20-12(14,15)16/h1-2,4,7,18H,3,5-6H2 |
| InChIKey | MWKAQJASGKTKST-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|