C12H11F3N4O3 — CID 168657688
4-(azidomethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 168657688) has the molecular formula C12H11F3N4O3 and a molecular weight of 316.24 g/mol. Its IUPAC name is 4-(azidomethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657688 |
| Molecular Formula | C12H11F3N4O3 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-(azidomethyl)-1-[2-hydroxy-5-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2cc(OC(F)(F)F)ccc2O)C1 |
| InChI | InChI=1S/C12H11F3N4O3/c13-12(14,15)22-8-1-2-10(20)9(4-8)19-6-7(3-11(19)21)5-17-18-16/h1-2,4,7,20H,3,5-6H2 |
| InChIKey | KNGBFNNQCOYZES-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|