C12H9BrF2N2OS — CID 168506315
4-(bromomethyl)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)pyrrolidin-2-one (PubChem CID 168506315) has the molecular formula C12H9BrF2N2OS and a molecular weight of 347.18 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506315 |
| Molecular Formula | C12H9BrF2N2OS |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 4-(bromomethyl)-1-(4,6-difluoro-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C12H9BrF2N2OS/c13-4-6-1-10(18)17(5-6)12-16-11-8(15)2-7(14)3-9(11)19-12/h2-3,6H,1,4-5H2 |
| InChIKey | WFAGQMLXIBLABY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|