C12H10Br2N2OS — CID 168506318
1-(5-bromo-1,3-benzothiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one (PubChem CID 168506318) has the molecular formula C12H10Br2N2OS and a molecular weight of 390.10 g/mol. Its IUPAC name is 1-(5-bromo-1,3-benzothiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-bromo-1,3-benzothiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506318 |
| Molecular Formula | C12H10Br2N2OS |
| Molecular Weight | 390.10 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | 1-(5-bromo-1,3-benzothiazol-2-yl)-4-(bromomethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1nc2cc(Br)ccc2s1 |
| InChI | InChI=1S/C12H10Br2N2OS/c13-5-7-3-11(17)16(6-7)12-15-9-4-8(14)1-2-10(9)18-12/h1-2,4,7H,3,5-6H2 |
| InChIKey | XGWFQAGJZTWXMR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|