C12H13N3O2S — CID 168699556
4-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one (PubChem CID 168699556) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168699556 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-amino-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
| SMILES | COc1ccc2sc(N3CC(N)CC3=O)nc2c1 |
| InChI | InChI=1S/C12H13N3O2S/c1-17-8-2-3-10-9(5-8)14-12(18-10)15-6-7(13)4-11(15)16/h2-3,5,7H,4,6,13H2,1H3 |
| InChIKey | HEJHJAZGDNPKRQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |