C14H14N2O2S — CID 168684485
4-ethenyl-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one (PubChem CID 168684485) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-ethenyl-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168684485 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-ethenyl-1-(5-methoxy-1,3-benzothiazol-2-yl)pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nc3cc(OC)ccc3s2)C1 |
| InChI | InChI=1S/C14H14N2O2S/c1-3-9-6-13(17)16(8-9)14-15-11-7-10(18-2)4-5-12(11)19-14/h3-5,7,9H,1,6,8H2,2H3 |
| InChIKey | ZAADFNKZYWXKGM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|