C8H10BrN3OS2 — CID 168504313
4-(bromomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one (PubChem CID 168504313) has the molecular formula C8H10BrN3OS2 and a molecular weight of 308.23 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168504313 |
| Molecular Formula | C8H10BrN3OS2 |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | 4-(bromomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one |
| SMILES | CSc1nsc(N2CC(CBr)CC2=O)n1 |
| InChI | InChI=1S/C8H10BrN3OS2/c1-14-7-10-8(15-11-7)12-4-5(3-9)2-6(12)13/h5H,2-4H2,1H3 |
| InChIKey | IKGFTYFFSQSRSJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|